اخبار و اعلانات

 آمار

تعداد نشریات418
تعداد شماره‌ها9,997
تعداد مقالات83,560
تعداد مشاهده مقاله77,802,036
تعداد دریافت فایل اصل مقاله54,844,431
1.

Snail shell as a natural and highly efficient catalyst for the synthesis of imidazole derivatives

صفحه 1-7
Zakaria Benzekribe؛ Houda Serrar؛ Abdelkebir Zarguil؛ Said Boukhris؛ Abdelaziz Souizi
2.

Synthesis of bis-thiazolidinones catalyzed by nano-NiZr4(PO4)6 under microwave irradiation

صفحه 9-16
Javad Safaei-Ghomi؛ Hossein Shahbazi-Alavi؛ Seyed Hadi Nazemzadeh
3.

Adsorptive desulfurization of oil derivatives using nanostructured Mg-Al layered double hydroxides: Experimental design and modeling

صفحه 17-27
Seyed Ali Hosseini؛ Mansor Akbari؛ Jalil Nikbakht
4.

Montmorillonite KSF as a very efficient heterogeneous catalyst for the synthesis of 5-substituted 1H-tetrazoles

صفحه 29-33
Rahman Hosseinzadeh؛ Zahra Lasemi؛ Farzaneh Maliji
5.

Fe3O4/SiO2/(CH2)3N+Me3Br3– core–shell nanoparticles: An efficient catalyst for the synthesis of functionalized 5-oxo-hexahydroquinolines

صفحه 35-39
Azita Farrokhi؛ Issa Yavari؛ Keivan Ghodrati
6.

Kinetics and thermodynamics of the esterification reaction according to the Langmuir-Hinshelwood mechanism

صفحه 41-46
Rohollah Ezzati
7.

Nano-Fe3O4@ZrO2-SO3H as highly efficient recyclable catalyst for the green synthesis of fluoroquinolones in ordinary or magnetized water

صفحه 47-52
Ahmad Nakhaei؛ Abolghasem Davoodnia؛ Sepideh Yadegarian
8.

Polyvinylpolypyrrolidone supported antimony(III) chloride (PVPP-SbCl3): An efficient catalyst for the synthesis of chromenylphenylpropanones

صفحه 53-58
Vahid Nabatchi Ahmadi؛ Masoud Mokhtary
9.

Synthesis of the biologically active henna based benzochromene derivatives using ionic liquid functionalized SBA-15 as a nanoreactor

صفحه 59-67
Ghodsi Mohammadi Ziarani؛ Hoda Mollabagher؛ Parisa Gholamzadeh؛ Alireza Badiei؛ Fatemeh Yazdian
10.

Spotlight: 2-Aminoethyl dihydrogen phosphate: As a multi-purpose spacer

صفحه 69-72
Meysam Yarie


سامانه مدیریت نشریات علمی. قدرت گرفته از سیناوب